C22H24N4 — CID 151752103
3-[[4-(4-pyridin-2-ylbut-3-ynyl)piperazin-2-yl]methyl]-1H-indole (PubChem CID 151752103) has the molecular formula C22H24N4 and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-[[4-(4-pyridin-2-ylbut-3-ynyl)piperazin-2-yl]methyl]-1H-indole.
| Compound Name | 3-[[4-(4-pyridin-2-ylbut-3-ynyl)piperazin-2-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 151752103 |
| Molecular Formula | C22H24N4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 3-[[4-(4-pyridin-2-ylbut-3-ynyl)piperazin-2-yl]methyl]-1H-indole |
| SMILES | C(#Cc1ccccn1)CCN1CCNC(Cc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C22H24N4/c1-2-10-22-21(9-1)18(16-25-22)15-20-17-26(14-12-24-20)13-6-4-8-19-7-3-5-11-23-19/h1-3,5,7,9-11,16,20,24-25H,6,12-15,17H2 |
| InChIKey | ROTYPSFDSAMBCT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|