C22H26Cl2N4 — CID 174405051
3-[[4-[3-(4-methyl-2-pyridinyl)prop-2-ynyl]piperazin-2-yl]methyl]-1H-indole;dihydrochloride (PubChem CID 174405051) has the molecular formula C22H26Cl2N4 and a molecular weight of 417.38 g/mol. Its IUPAC name is 3-[[4-[3-(4-methyl-2-pyridinyl)prop-2-ynyl]piperazin-2-yl]methyl]-1H-indole;dihydrochloride.
| Compound Name | 3-[[4-[3-(4-methyl-2-pyridinyl)prop-2-ynyl]piperazin-2-yl]methyl]-1H-indole;dihydrochloride |
|---|---|
| PubChem CID | 174405051 |
| Molecular Formula | C22H26Cl2N4 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 3-[[4-[3-(4-methyl-2-pyridinyl)prop-2-ynyl]piperazin-2-yl]methyl]-1H-indole;dihydrochloride |
| SMILES | Cc1ccnc(C#CCN2CCNC(Cc3c[nH]c4ccccc34)C2)c1.Cl.Cl |
| InChI | InChI=1S/C22H24N4.2ClH/c1-17-8-9-23-19(13-17)5-4-11-26-12-10-24-20(16-26)14-18-15-25-22-7-3-2-6-21(18)22;;/h2-3,6-9,13,15,20,24-25H,10-12,14,16H2,1H3;2*1H |
| InChIKey | BXMGPYMVRPERAV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|