C14H18O7 — CID 15175271
ethyl 2-(2-ethoxy-2-oxoethyl)-7-oxo-1,6-dioxaspiro[4.4]non-2-ene-3-carboxylate (PubChem CID 15175271) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is ethyl 2-(2-ethoxy-2-oxoethyl)-7-oxo-1,6-dioxaspiro[4.4]non-2-ene-3-carboxylate.
| Compound Name | ethyl 2-(2-ethoxy-2-oxoethyl)-7-oxo-1,6-dioxaspiro[4.4]non-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 15175271 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | ethyl 2-(2-ethoxy-2-oxoethyl)-7-oxo-1,6-dioxaspiro[4.4]non-2-ene-3-carboxylate |
| SMILES | CCOC(=O)CC1=C(C(=O)OCC)CC2(CCC(=O)O2)O1 |
| InChI | InChI=1S/C14H18O7/c1-3-18-12(16)7-10-9(13(17)19-4-2)8-14(20-10)6-5-11(15)21-14/h3-8H2,1-2H3 |
| InChIKey | HOFYAHNAAZDSNE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|