C13H16O9 — CID 73069438
dimethyl 2,2-dimethoxy-7-oxo-1,6-dioxaspiro[4.4]non-3-ene-3,4-dicarboxylate (PubChem CID 73069438) has the molecular formula C13H16O9 and a molecular weight of 316.26 g/mol. Its IUPAC name is dimethyl 2,2-dimethoxy-7-oxo-1,6-dioxaspiro[4.4]non-3-ene-3,4-dicarboxylate.
| Compound Name | dimethyl 2,2-dimethoxy-7-oxo-1,6-dioxaspiro[4.4]non-3-ene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 73069438 |
| Molecular Formula | C13H16O9 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | dimethyl 2,2-dimethoxy-7-oxo-1,6-dioxaspiro[4.4]non-3-ene-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(OC)(OC)OC12CCC(=O)O2 |
| InChI | InChI=1S/C13H16O9/c1-17-10(15)8-9(11(16)18-2)13(19-3,20-4)22-12(8)6-5-7(14)21-12/h5-6H2,1-4H3 |
| InChIKey | WHJDNLVIHDWMCS-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|