methyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate

C12H18O5 — CID 162939942

IUPACmethyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate
SMILESCCO[C@@]1(CCC(=O)OC)OC(=O)C(C)=C1C
InChIInChI=1S/C12H18O5/c1-5-16-12(7-6-10(13)15-4)9(3)8(2)11(14)17-12/h5-7H2,1-4H3/t12-/m0/s1
InChIKeyKZMWIKBWSRVQNN-LBPRGKRZSA-N
MW242.27 g/mol
LogP1.57
Rot. Bonds5

About methyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate

methyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate (PubChem CID 162939942) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is methyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate.

Molecular Properties

Compound Namemethyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate
PubChem CID162939942
Molecular FormulaC12H18O5
Molecular Weight242.27 g/mol
Exact Mass242.12
IUPAC Namemethyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate
SMILESCCO[C@@]1(CCC(=O)OC)OC(=O)C(C)=C1C
InChIInChI=1S/C12H18O5/c1-5-16-12(7-6-10(13)15-4)9(3)8(2)11(14)17-12/h5-7H2,1-4H3/t12-/m0/s1
InChIKeyKZMWIKBWSRVQNN-LBPRGKRZSA-N
XLogP1.57
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.27
LogP ≤ 51.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate?
The IUPAC name of methyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate (CID 162939942) is methyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate.
What is the SMILES notation for methyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate?
The canonical SMILES for methyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate is CCO[C@@]1(CCC(=O)OC)OC(=O)C(C)=C1C.
What is the InChIKey of methyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate?
The InChIKey is KZMWIKBWSRVQNN-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H18O5/c1-5-16-12(7-6-10(13)15-4)9(3)8(2)11(14)17-12/h5-7H2,1-4H3/t12-/m0/s1.
What are the key properties of methyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate?
methyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate has a molecular weight of 242.27 g/mol, XLogP of 1.57, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2S)-2-ethoxy-3,4-dimethyl-5-oxofuran-2-yl]propanoate is sourced from PubChem (CID 162939942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).