C13H9ClF2N2O4S — CID 151758566
N-(2-chloro-5-formyl-3-pyridinyl)-3-(difluoromethoxy)benzenesulfonamide (PubChem CID 151758566) has the molecular formula C13H9ClF2N2O4S and a molecular weight of 362.74 g/mol. Its IUPAC name is N-(2-chloro-5-formyl-3-pyridinyl)-3-(difluoromethoxy)benzenesulfonamide.
| Compound Name | N-(2-chloro-5-formyl-3-pyridinyl)-3-(difluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 151758566 |
| Molecular Formula | C13H9ClF2N2O4S |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | N-(2-chloro-5-formyl-3-pyridinyl)-3-(difluoromethoxy)benzenesulfonamide |
| SMILES | O=Cc1cnc(Cl)c(NS(=O)(=O)c2cccc(OC(F)F)c2)c1 |
| InChI | InChI=1S/C13H9ClF2N2O4S/c14-12-11(4-8(7-19)6-17-12)18-23(20,21)10-3-1-2-9(5-10)22-13(15)16/h1-7,13,18H |
| InChIKey | RQBIEFRCHSBIOE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|