C22H35N2+ — CID 151765558
3-(3-benzyldodecan-2-yl)-1H-imidazol-3-ium (PubChem CID 151765558) has the molecular formula C22H35N2+ and a molecular weight of 327.54 g/mol. Its IUPAC name is 3-(3-benzyldodecan-2-yl)-1H-imidazol-3-ium.
| Compound Name | 3-(3-benzyldodecan-2-yl)-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 151765558 |
| Molecular Formula | C22H35N2+ |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.28 |
| IUPAC Name | 3-(3-benzyldodecan-2-yl)-1H-imidazol-3-ium |
| SMILES | CCCCCCCCCC(Cc1ccccc1)C(C)[n+]1cc[nH]c1 |
| InChI | InChI=1S/C22H34N2/c1-3-4-5-6-7-8-12-15-22(18-21-13-10-9-11-14-21)20(2)24-17-16-23-19-24/h9-11,13-14,16-17,19-20,22H,3-8,12,15,18H2,1-2H3/p+1 |
| InChIKey | RRMPKYWRWFOJRQ-UHFFFAOYSA-O |
| XLogP | 5.86 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|