C8H10N2O3 — CID 15176646
(3E)-1-acetyl-3-ethylidenepiperazine-2,5-dione (PubChem CID 15176646) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is (3E)-1-acetyl-3-ethylidenepiperazine-2,5-dione.
| Compound Name | (3E)-1-acetyl-3-ethylidenepiperazine-2,5-dione |
|---|---|
| PubChem CID | 15176646 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | (3E)-1-acetyl-3-ethylidenepiperazine-2,5-dione |
| SMILES | C/C=C1/NC(=O)CN(C(C)=O)C1=O |
| InChI | InChI=1S/C8H10N2O3/c1-3-6-8(13)10(5(2)11)4-7(12)9-6/h3H,4H2,1-2H3,(H,9,12)/b6-3+ |
| InChIKey | QHGJYSHFKBLXAJ-ZZXKWVIFSA-N |
| XLogP | -0.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|