C18H13F3N6O3 — CID 151770681
1-[5-nitro-1-(pyridin-3-ylmethyl)-2H-pyrimidin-2-yl]-5-(trifluoromethoxy)benzimidazole (PubChem CID 151770681) has the molecular formula C18H13F3N6O3 and a molecular weight of 418.34 g/mol. Its IUPAC name is 1-[5-nitro-1-(pyridin-3-ylmethyl)-2H-pyrimidin-2-yl]-5-(trifluoromethoxy)benzimidazole.
| Compound Name | 1-[5-nitro-1-(pyridin-3-ylmethyl)-2H-pyrimidin-2-yl]-5-(trifluoromethoxy)benzimidazole |
|---|---|
| PubChem CID | 151770681 |
| Molecular Formula | C18H13F3N6O3 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 1-[5-nitro-1-(pyridin-3-ylmethyl)-2H-pyrimidin-2-yl]-5-(trifluoromethoxy)benzimidazole |
| SMILES | O=[N+]([O-])C1=CN(Cc2cccnc2)C(n2cnc3cc(OC(F)(F)F)ccc32)N=C1 |
| InChI | InChI=1S/C18H13F3N6O3/c19-18(20,21)30-14-3-4-16-15(6-14)24-11-26(16)17-23-8-13(27(28)29)10-25(17)9-12-2-1-5-22-7-12/h1-8,10-11,17H,9H2 |
| InChIKey | RSNCDXUNJKDBEO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 98.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|