C11H11NO3 — CID 151771491
2-(1-benzofuran-6-yl)ethyl carbamate (PubChem CID 151771491) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-(1-benzofuran-6-yl)ethyl carbamate.
| Compound Name | 2-(1-benzofuran-6-yl)ethyl carbamate |
|---|---|
| PubChem CID | 151771491 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-(1-benzofuran-6-yl)ethyl carbamate |
| SMILES | NC(=O)OCCc1ccc2ccoc2c1 |
| InChI | InChI=1S/C11H11NO3/c12-11(13)15-5-3-8-1-2-9-4-6-14-10(9)7-8/h1-2,4,6-7H,3,5H2,(H2,12,13) |
| InChIKey | RSRGJMUZEYMXRK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |