C16H25NO5 — CID 151771914
[1-[(1R,5R,6R)-3-(methoxymethyl)-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-2-methylpropan-2-yl] acetate (PubChem CID 151771914) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is [1-[(1R,5R,6R)-3-(methoxymethyl)-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-2-methylpropan-2-yl] acetate.
| Compound Name | [1-[(1R,5R,6R)-3-(methoxymethyl)-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-2-methylpropan-2-yl] acetate |
|---|---|
| PubChem CID | 151771914 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | [1-[(1R,5R,6R)-3-(methoxymethyl)-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-2-methylpropan-2-yl] acetate |
| SMILES | COCC1=C[C@H]2[C@@H](C1)C[C@@]2(C[N+](=O)[O-])CC(C)(C)OC(C)=O |
| InChI | InChI=1S/C16H25NO5/c1-11(18)22-15(2,3)9-16(10-17(19)20)7-13-5-12(8-21-4)6-14(13)16/h6,13-14H,5,7-10H2,1-4H3/t13-,14-,16-/m0/s1 |
| InChIKey | RSTHFNUQEPWIDI-DZKIICNBSA-N |
| XLogP | 2.59 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|