C16H25NO4 — CID 172713553
[1-[(1S,5R,6R)-3,4-dimethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-2-methylpropan-2-yl] acetate (PubChem CID 172713553) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is [1-[(1S,5R,6R)-3,4-dimethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-2-methylpropan-2-yl] acetate.
| Compound Name | [1-[(1S,5R,6R)-3,4-dimethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-2-methylpropan-2-yl] acetate |
|---|---|
| PubChem CID | 172713553 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | [1-[(1S,5R,6R)-3,4-dimethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-2-methylpropan-2-yl] acetate |
| SMILES | CC(=O)OC(C)(C)C[C@]1(C[N+](=O)[O-])C[C@@H]2CC(C)=C(C)[C@@H]21 |
| InChI | InChI=1S/C16H25NO4/c1-10-6-13-7-16(9-17(19)20,14(13)11(10)2)8-15(4,5)21-12(3)18/h13-14H,6-9H2,1-5H3/t13-,14-,16-/m0/s1 |
| InChIKey | FOGMCGXLCJJZLR-DZKIICNBSA-N |
| XLogP | 3.36 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|