C23H24O4S — CID 15177784
diethyl (2R,5S)-2,5-diphenyl-2,5-dihydrothiopyran-6,6-dicarboxylate (PubChem CID 15177784) has the molecular formula C23H24O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is diethyl (2R,5S)-2,5-diphenyl-2,5-dihydrothiopyran-6,6-dicarboxylate.
| Compound Name | diethyl (2R,5S)-2,5-diphenyl-2,5-dihydrothiopyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 15177784 |
| Molecular Formula | C23H24O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | diethyl (2R,5S)-2,5-diphenyl-2,5-dihydrothiopyran-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)S[C@@H](c2ccccc2)C=C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H24O4S/c1-3-26-21(24)23(22(25)27-4-2)19(17-11-7-5-8-12-17)15-16-20(28-23)18-13-9-6-10-14-18/h5-16,19-20H,3-4H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | IWPZCQMFKXMQPJ-VQTJNVASSA-N |
| XLogP | 4.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|