cyclopropyl 2,3-dimethylbut-2-enedithioate

C9H14S2 — CID 15178435

IUPACcyclopropyl 2,3-dimethylbut-2-enedithioate
SMILESCC(C)=C(C)C(=S)SC1CC1
InChIInChI=1S/C9H14S2/c1-6(2)7(3)9(10)11-8-4-5-8/h8H,4-5H2,1-3H3
InChIKeySUNQFLMZWFQFML-UHFFFAOYSA-N
MW186.34 g/mol
LogP3.57
Rot. Bonds2

About cyclopropyl 2,3-dimethylbut-2-enedithioate

cyclopropyl 2,3-dimethylbut-2-enedithioate (PubChem CID 15178435) has the molecular formula C9H14S2 and a molecular weight of 186.34 g/mol. Its IUPAC name is cyclopropyl 2,3-dimethylbut-2-enedithioate.

Molecular Properties

Compound Namecyclopropyl 2,3-dimethylbut-2-enedithioate
PubChem CID15178435
Molecular FormulaC9H14S2
Molecular Weight186.34 g/mol
Exact Mass186.05
IUPAC Namecyclopropyl 2,3-dimethylbut-2-enedithioate
SMILESCC(C)=C(C)C(=S)SC1CC1
InChIInChI=1S/C9H14S2/c1-6(2)7(3)9(10)11-8-4-5-8/h8H,4-5H2,1-3H3
InChIKeySUNQFLMZWFQFML-UHFFFAOYSA-N
XLogP3.57
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.34
LogP ≤ 53.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze cyclopropyl 2,3-dimethylbut-2-enedithioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclopropyl 2,3-dimethylbut-2-enedithioate?
The IUPAC name of cyclopropyl 2,3-dimethylbut-2-enedithioate (CID 15178435) is cyclopropyl 2,3-dimethylbut-2-enedithioate.
What is the SMILES notation for cyclopropyl 2,3-dimethylbut-2-enedithioate?
The canonical SMILES for cyclopropyl 2,3-dimethylbut-2-enedithioate is CC(C)=C(C)C(=S)SC1CC1.
What is the InChIKey of cyclopropyl 2,3-dimethylbut-2-enedithioate?
The InChIKey is SUNQFLMZWFQFML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14S2/c1-6(2)7(3)9(10)11-8-4-5-8/h8H,4-5H2,1-3H3.
What are the key properties of cyclopropyl 2,3-dimethylbut-2-enedithioate?
cyclopropyl 2,3-dimethylbut-2-enedithioate has a molecular weight of 186.34 g/mol, XLogP of 3.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl 2,3-dimethylbut-2-enedithioate is sourced from PubChem (CID 15178435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).