C9H14S2 — CID 15178435
cyclopropyl 2,3-dimethylbut-2-enedithioate (PubChem CID 15178435) has the molecular formula C9H14S2 and a molecular weight of 186.34 g/mol. Its IUPAC name is cyclopropyl 2,3-dimethylbut-2-enedithioate.
| Compound Name | cyclopropyl 2,3-dimethylbut-2-enedithioate |
|---|---|
| PubChem CID | 15178435 |
| Molecular Formula | C9H14S2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | cyclopropyl 2,3-dimethylbut-2-enedithioate |
| SMILES | CC(C)=C(C)C(=S)SC1CC1 |
| InChI | InChI=1S/C9H14S2/c1-6(2)7(3)9(10)11-8-4-5-8/h8H,4-5H2,1-3H3 |
| InChIKey | SUNQFLMZWFQFML-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|