C13H14N4O2 — CID 15178792
1-methyl-2-(4-nitrophenyl)-5,6-dihydro-4H-benzotriazole (PubChem CID 15178792) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 1-methyl-2-(4-nitrophenyl)-5,6-dihydro-4H-benzotriazole.
| Compound Name | 1-methyl-2-(4-nitrophenyl)-5,6-dihydro-4H-benzotriazole |
|---|---|
| PubChem CID | 15178792 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 1-methyl-2-(4-nitrophenyl)-5,6-dihydro-4H-benzotriazole |
| SMILES | CN1C2=CCCCC2=NN1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H14N4O2/c1-15-13-5-3-2-4-12(13)14-16(15)10-6-8-11(9-7-10)17(18)19/h5-9H,2-4H2,1H3 |
| InChIKey | LUJAQMMTGNARQI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|