C10H11N3O2 — CID 171384858
3-methyl-2-(4-nitrophenyl)-3,4-dihydropyrazole (PubChem CID 171384858) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 3-methyl-2-(4-nitrophenyl)-3,4-dihydropyrazole.
| Compound Name | 3-methyl-2-(4-nitrophenyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 171384858 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3-methyl-2-(4-nitrophenyl)-3,4-dihydropyrazole |
| SMILES | CC1CC=NN1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H11N3O2/c1-8-6-7-11-12(8)9-2-4-10(5-3-9)13(14)15/h2-5,7-8H,6H2,1H3 |
| InChIKey | WVWOOMKDWZJUNW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|