C10H16O2 — CID 151788696
6-methyl-4-oxatricyclo[5.2.1.03,8]decan-2-ol (PubChem CID 151788696) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 6-methyl-4-oxatricyclo[5.2.1.03,8]decan-2-ol.
| Compound Name | 6-methyl-4-oxatricyclo[5.2.1.03,8]decan-2-ol |
|---|---|
| PubChem CID | 151788696 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 6-methyl-4-oxatricyclo[5.2.1.03,8]decan-2-ol |
| SMILES | CC1COC2C(O)C3CC1C2C3 |
| InChI | InChI=1S/C10H16O2/c1-5-4-12-10-8-3-6(9(10)11)2-7(5)8/h5-11H,2-4H2,1H3 |
| InChIKey | RWDUJUQMZKRXMA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |