C11H18F2N4O2Si — CID 151791600
[3,3-difluoro-1-[1-(trimethylsilylmethyl)triazol-4-yl]cyclobutyl]carbamic acid (PubChem CID 151791600) has the molecular formula C11H18F2N4O2Si and a molecular weight of 304.37 g/mol. Its IUPAC name is [3,3-difluoro-1-[1-(trimethylsilylmethyl)triazol-4-yl]cyclobutyl]carbamic acid.
| Compound Name | [3,3-difluoro-1-[1-(trimethylsilylmethyl)triazol-4-yl]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 151791600 |
| Molecular Formula | C11H18F2N4O2Si |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | [3,3-difluoro-1-[1-(trimethylsilylmethyl)triazol-4-yl]cyclobutyl]carbamic acid |
| SMILES | C[Si](C)(C)Cn1cc(C2(NC(=O)O)CC(F)(F)C2)nn1 |
| InChI | InChI=1S/C11H18F2N4O2Si/c1-20(2,3)7-17-4-8(15-16-17)10(14-9(18)19)5-11(12,13)6-10/h4,14H,5-7H2,1-3H3,(H,18,19) |
| InChIKey | RWSRTHXQUBJCED-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|