C14H26N4O — CID 154687902
ethane;2-methyl-N-[1-(1-propyltriazol-4-yl)cyclopropyl]propanamide (PubChem CID 154687902) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is ethane;2-methyl-N-[1-(1-propyltriazol-4-yl)cyclopropyl]propanamide.
| Compound Name | ethane;2-methyl-N-[1-(1-propyltriazol-4-yl)cyclopropyl]propanamide |
|---|---|
| PubChem CID | 154687902 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | ethane;2-methyl-N-[1-(1-propyltriazol-4-yl)cyclopropyl]propanamide |
| SMILES | CC.CCCn1cc(C2(NC(=O)C(C)C)CC2)nn1 |
| InChI | InChI=1S/C12H20N4O.C2H6/c1-4-7-16-8-10(14-15-16)12(5-6-12)13-11(17)9(2)3;1-2/h8-9H,4-7H2,1-3H3,(H,13,17);1-2H3 |
| InChIKey | SRBILJXWKGWSPR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |