About 3-azido-2-decoxyacridine
3-azido-2-decoxyacridine (PubChem CID 151791607) has the molecular formula C23H28N4O
and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-azido-2-decoxyacridine.
Molecular Properties
| Compound Name | 3-azido-2-decoxyacridine |
| PubChem CID | 151791607 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 3-azido-2-decoxyacridine |
| SMILES | CCCCCCCCCCOc1cc2cc3ccccc3nc2cc1N=[N+]=[N-] |
| InChI | InChI=1S/C23H28N4O/c1-2-3-4-5-6-7-8-11-14-28-23-16-19-15-18-12-9-10-13-20(18)25-21(19)17-22(23)26-27-24/h9-10,12-13,15-17H,2-8,11,14H2,1H3 |
| InChIKey | RWSSRSIFIBRMMA-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 70.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-azido-2-decoxyacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azido-2-decoxyacridine?
The IUPAC name of 3-azido-2-decoxyacridine (CID 151791607) is 3-azido-2-decoxyacridine.
What is the SMILES notation for 3-azido-2-decoxyacridine?
The canonical SMILES for 3-azido-2-decoxyacridine is CCCCCCCCCCOc1cc2cc3ccccc3nc2cc1N=[N+]=[N-].
What is the InChIKey of 3-azido-2-decoxyacridine?
The InChIKey is RWSSRSIFIBRMMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N4O/c1-2-3-4-5-6-7-8-11-14-28-23-16-19-15-18-12-9-10-13-20(18)25-21(19)17-22(23)26-27-24/h9-10,12-13,15-17H,2-8,11,14H2,1H3.
What are the key properties of 3-azido-2-decoxyacridine?
3-azido-2-decoxyacridine has a molecular weight of 376.50 g/mol, XLogP of 7.85, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azido-2-decoxyacridine is sourced from PubChem (CID 151791607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).