C13H7Cl2N3O3S — CID 151802903
7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine-6-carbaldehyde (PubChem CID 151802903) has the molecular formula C13H7Cl2N3O3S and a molecular weight of 356.19 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine-6-carbaldehyde.
| Compound Name | 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine-6-carbaldehyde |
|---|---|
| PubChem CID | 151802903 |
| Molecular Formula | C13H7Cl2N3O3S |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 354.96 |
| IUPAC Name | 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine-6-carbaldehyde |
| SMILES | O=Cc1cc2c(Cl)nc(Cl)nc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H7Cl2N3O3S/c14-11-10-6-8(7-19)18(12(10)17-13(15)16-11)22(20,21)9-4-2-1-3-5-9/h1-7H |
| InChIKey | RYZLPPHISJAQTC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|