3-methoxypyrazole-1-carboxylic acid

C5H6N2O3 — CID 151813359

IUPAC3-methoxypyrazole-1-carboxylic acid
SMILESCOc1ccn(C(=O)O)n1
InChIInChI=1S/C5H6N2O3/c1-10-4-2-3-7(6-4)5(8)9/h2-3H,1H3,(H,8,9)
InChIKeySBBSPAOZGLXBGJ-UHFFFAOYSA-N
MW142.11 g/mol
LogP0.42
Rot. Bonds1

About 3-methoxypyrazole-1-carboxylic acid

3-methoxypyrazole-1-carboxylic acid (PubChem CID 151813359) has the molecular formula C5H6N2O3 and a molecular weight of 142.11 g/mol. Its IUPAC name is 3-methoxypyrazole-1-carboxylic acid.

Molecular Properties

Compound Name3-methoxypyrazole-1-carboxylic acid
PubChem CID151813359
Molecular FormulaC5H6N2O3
Molecular Weight142.11 g/mol
Exact Mass142.04
IUPAC Name3-methoxypyrazole-1-carboxylic acid
SMILESCOc1ccn(C(=O)O)n1
InChIInChI=1S/C5H6N2O3/c1-10-4-2-3-7(6-4)5(8)9/h2-3H,1H3,(H,8,9)
InChIKeySBBSPAOZGLXBGJ-UHFFFAOYSA-N
XLogP0.42
TPSA64.35 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.11
LogP ≤ 50.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-methoxypyrazole-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methoxypyrazole-1-carboxylic acid?
The IUPAC name of 3-methoxypyrazole-1-carboxylic acid (CID 151813359) is 3-methoxypyrazole-1-carboxylic acid.
What is the SMILES notation for 3-methoxypyrazole-1-carboxylic acid?
The canonical SMILES for 3-methoxypyrazole-1-carboxylic acid is COc1ccn(C(=O)O)n1.
What is the InChIKey of 3-methoxypyrazole-1-carboxylic acid?
The InChIKey is SBBSPAOZGLXBGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3/c1-10-4-2-3-7(6-4)5(8)9/h2-3H,1H3,(H,8,9).
What are the key properties of 3-methoxypyrazole-1-carboxylic acid?
3-methoxypyrazole-1-carboxylic acid has a molecular weight of 142.11 g/mol, XLogP of 0.42, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypyrazole-1-carboxylic acid is sourced from PubChem (CID 151813359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).