C15H14N2O2S — CID 15181442
1-hydroxy-1-[1-[4-(2-thiophen-2-ylethynyl)phenyl]ethyl]urea (PubChem CID 15181442) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 1-hydroxy-1-[1-[4-(2-thiophen-2-ylethynyl)phenyl]ethyl]urea.
| Compound Name | 1-hydroxy-1-[1-[4-(2-thiophen-2-ylethynyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 15181442 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-hydroxy-1-[1-[4-(2-thiophen-2-ylethynyl)phenyl]ethyl]urea |
| SMILES | CC(c1ccc(C#Cc2cccs2)cc1)N(O)C(N)=O |
| InChI | InChI=1S/C15H14N2O2S/c1-11(17(19)15(16)18)13-7-4-12(5-8-13)6-9-14-3-2-10-20-14/h2-5,7-8,10-11,19H,1H3,(H2,16,18) |
| InChIKey | IYFRWXXGDRIZFX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|