C10H9NO3S — CID 151816538
5-(4-hydroxyphenyl)-3-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 151816538) has the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)-3-methyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(4-hydroxyphenyl)-3-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 151816538 |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 5-(4-hydroxyphenyl)-3-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | CN1C(=O)SC(c2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C10H9NO3S/c1-11-9(13)8(15-10(11)14)6-2-4-7(12)5-3-6/h2-5,8,12H,1H3 |
| InChIKey | SBSFMJZIHHOMTA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|