C14H10F3N3O3S — CID 151819833
N-methoxy-1-[7-(1,3-thiazol-2-yl)-4-(trifluoromethoxy)-1,3-benzoxazol-5-yl]ethanimine (PubChem CID 151819833) has the molecular formula C14H10F3N3O3S and a molecular weight of 357.31 g/mol. Its IUPAC name is N-methoxy-1-[7-(1,3-thiazol-2-yl)-4-(trifluoromethoxy)-1,3-benzoxazol-5-yl]ethanimine.
| Compound Name | N-methoxy-1-[7-(1,3-thiazol-2-yl)-4-(trifluoromethoxy)-1,3-benzoxazol-5-yl]ethanimine |
|---|---|
| PubChem CID | 151819833 |
| Molecular Formula | C14H10F3N3O3S |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | N-methoxy-1-[7-(1,3-thiazol-2-yl)-4-(trifluoromethoxy)-1,3-benzoxazol-5-yl]ethanimine |
| SMILES | CON=C(C)c1cc(-c2nccs2)c2ocnc2c1OC(F)(F)F |
| InChI | InChI=1S/C14H10F3N3O3S/c1-7(20-21-2)8-5-9(13-18-3-4-24-13)11-10(19-6-22-11)12(8)23-14(15,16)17/h3-6H,1-2H3 |
| InChIKey | SCJWZOPRLQIQKW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 69.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|