C10H13NO4 — CID 15182089
(5-methoxy-3-oxo-2-azabicyclo[2.2.0]hex-5-en-2-yl)methyl propanoate (PubChem CID 15182089) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is (5-methoxy-3-oxo-2-azabicyclo[2.2.0]hex-5-en-2-yl)methyl propanoate.
| Compound Name | (5-methoxy-3-oxo-2-azabicyclo[2.2.0]hex-5-en-2-yl)methyl propanoate |
|---|---|
| PubChem CID | 15182089 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (5-methoxy-3-oxo-2-azabicyclo[2.2.0]hex-5-en-2-yl)methyl propanoate |
| SMILES | CCC(=O)OCN1C(=O)C2C(OC)=CC21 |
| InChI | InChI=1S/C10H13NO4/c1-3-8(12)15-5-11-6-4-7(14-2)9(6)10(11)13/h4,6,9H,3,5H2,1-2H3 |
| InChIKey | LZJBICIEALEQOD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |