C14H22N6O6 — CID 151854561
2-[(1-amino-2-methyl-3-nitro-1-oxohex-5-en-2-yl)diazenyl]-2-methyl-3-nitrohex-5-enamide (PubChem CID 151854561) has the molecular formula C14H22N6O6 and a molecular weight of 370.37 g/mol. Its IUPAC name is 2-[(1-amino-2-methyl-3-nitro-1-oxohex-5-en-2-yl)diazenyl]-2-methyl-3-nitrohex-5-enamide.
| Compound Name | 2-[(1-amino-2-methyl-3-nitro-1-oxohex-5-en-2-yl)diazenyl]-2-methyl-3-nitrohex-5-enamide |
|---|---|
| PubChem CID | 151854561 |
| Molecular Formula | C14H22N6O6 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-[(1-amino-2-methyl-3-nitro-1-oxohex-5-en-2-yl)diazenyl]-2-methyl-3-nitrohex-5-enamide |
| SMILES | C=CCC([N+](=O)[O-])C(C)(/N=N/C(C)(C(N)=O)C(CC=C)[N+](=O)[O-])C(N)=O |
| InChI | InChI=1S/C14H22N6O6/c1-5-7-9(19(23)24)13(3,11(15)21)17-18-14(4,12(16)22)10(8-6-2)20(25)26/h5-6,9-10H,1-2,7-8H2,3-4H3,(H2,15,21)(H2,16,22)/b18-17+ |
| InChIKey | SJKDLQWRTMRBHV-ISLYRVAYSA-N |
| XLogP | 0.37 |
| TPSA | 197.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|