About methyl 3-azido-5-formylbenzoate
methyl 3-azido-5-formylbenzoate (PubChem CID 151860200) has the molecular formula C9H7N3O3
and a molecular weight of 205.17 g/mol. Its IUPAC name is methyl 3-azido-5-formylbenzoate.
Molecular Properties
| Compound Name | methyl 3-azido-5-formylbenzoate |
| PubChem CID | 151860200 |
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | methyl 3-azido-5-formylbenzoate |
| SMILES | COC(=O)c1cc(C=O)cc(N=[N+]=[N-])c1 |
| InChI | InChI=1S/C9H7N3O3/c1-15-9(14)7-2-6(5-13)3-8(4-7)11-12-10/h2-5H,1H3 |
| InChIKey | SKOCPJXXWGFCSE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-azido-5-formylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-azido-5-formylbenzoate?
The IUPAC name of methyl 3-azido-5-formylbenzoate (CID 151860200) is methyl 3-azido-5-formylbenzoate.
What is the SMILES notation for methyl 3-azido-5-formylbenzoate?
The canonical SMILES for methyl 3-azido-5-formylbenzoate is COC(=O)c1cc(C=O)cc(N=[N+]=[N-])c1.
What is the InChIKey of methyl 3-azido-5-formylbenzoate?
The InChIKey is SKOCPJXXWGFCSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O3/c1-15-9(14)7-2-6(5-13)3-8(4-7)11-12-10/h2-5H,1H3.
What are the key properties of methyl 3-azido-5-formylbenzoate?
methyl 3-azido-5-formylbenzoate has a molecular weight of 205.17 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-azido-5-formylbenzoate is sourced from PubChem (CID 151860200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).