C21H23NO — CID 151872014
3-benzyl-1-(3-phenylbut-1-en-2-yl)pyrrolidin-2-one (PubChem CID 151872014) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is 3-benzyl-1-(3-phenylbut-1-en-2-yl)pyrrolidin-2-one.
| Compound Name | 3-benzyl-1-(3-phenylbut-1-en-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 151872014 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 3-benzyl-1-(3-phenylbut-1-en-2-yl)pyrrolidin-2-one |
| SMILES | C=C(C(C)c1ccccc1)N1CCC(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C21H23NO/c1-16(19-11-7-4-8-12-19)17(2)22-14-13-20(21(22)23)15-18-9-5-3-6-10-18/h3-12,16,20H,2,13-15H2,1H3 |
| InChIKey | SMWSKMKDCAZWAP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |