C15H16N6O2 — CID 151872269
1-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazole-5-carboxamide (PubChem CID 151872269) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is 1-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazole-5-carboxamide.
| Compound Name | 1-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 151872269 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazole-5-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)Nn1cnc2cc(C(N)=O)ccc21 |
| InChI | InChI=1S/C15H16N6O2/c1-3-20-13(6-9(2)18-20)15(23)19-21-8-17-11-7-10(14(16)22)4-5-12(11)21/h4-8H,3H2,1-2H3,(H2,16,22)(H,19,23) |
| InChIKey | SMYCUHARHGMWHT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |