C9H11N5S2 — CID 151884839
2-[3-(2H-tetrazol-5-ylsulfanyl)propylsulfanyl]pyridine (PubChem CID 151884839) has the molecular formula C9H11N5S2 and a molecular weight of 253.36 g/mol. Its IUPAC name is 2-[3-(2H-tetrazol-5-ylsulfanyl)propylsulfanyl]pyridine.
| Compound Name | 2-[3-(2H-tetrazol-5-ylsulfanyl)propylsulfanyl]pyridine |
|---|---|
| PubChem CID | 151884839 |
| Molecular Formula | C9H11N5S2 |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2-[3-(2H-tetrazol-5-ylsulfanyl)propylsulfanyl]pyridine |
| SMILES | c1ccc(SCCCSc2nn[nH]n2)nc1 |
| InChI | InChI=1S/C9H11N5S2/c1-2-5-10-8(4-1)15-6-3-7-16-9-11-13-14-12-9/h1-2,4-5H,3,6-7H2,(H,11,12,13,14) |
| InChIKey | SPMDOMMNRZOGTF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|