C11H14N4S2 — CID 151701206
5-(3-benzylsulfanylpropylsulfanyl)-2H-tetrazole (PubChem CID 151701206) has the molecular formula C11H14N4S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 5-(3-benzylsulfanylpropylsulfanyl)-2H-tetrazole.
| Compound Name | 5-(3-benzylsulfanylpropylsulfanyl)-2H-tetrazole |
|---|---|
| PubChem CID | 151701206 |
| Molecular Formula | C11H14N4S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 5-(3-benzylsulfanylpropylsulfanyl)-2H-tetrazole |
| SMILES | c1ccc(CSCCCSc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C11H14N4S2/c1-2-5-10(6-3-1)9-16-7-4-8-17-11-12-14-15-13-11/h1-3,5-6H,4,7-9H2,(H,12,13,14,15) |
| InChIKey | REQCSFVCFYZIBP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|