C3H4N8S2 — CID 54214977
5-(2H-tetrazol-5-ylsulfanylmethylsulfanyl)-2H-tetrazole (PubChem CID 54214977) has the molecular formula C3H4N8S2 and a molecular weight of 216.25 g/mol. Its IUPAC name is 5-(2H-tetrazol-5-ylsulfanylmethylsulfanyl)-2H-tetrazole.
| Compound Name | 5-(2H-tetrazol-5-ylsulfanylmethylsulfanyl)-2H-tetrazole |
|---|---|
| PubChem CID | 54214977 |
| Molecular Formula | C3H4N8S2 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | 5-(2H-tetrazol-5-ylsulfanylmethylsulfanyl)-2H-tetrazole |
| SMILES | C(Sc1nn[nH]n1)Sc1nn[nH]n1 |
| InChI | InChI=1S/C3H4N8S2/c1(12-2-4-8-9-5-2)13-3-6-10-11-7-3/h1H2,(H,4,5,8,9)(H,6,7,10,11) |
| InChIKey | QNEVCYHQAJHYHK-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|