C20H27FN2O3 — CID 151890176
1-cyclohexyl-N-[(3-fluorophenyl)methyl]-3-hydroxy-4-methyl-2-oxopiperidine-3-carboxamide (PubChem CID 151890176) has the molecular formula C20H27FN2O3 and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-cyclohexyl-N-[(3-fluorophenyl)methyl]-3-hydroxy-4-methyl-2-oxopiperidine-3-carboxamide.
| Compound Name | 1-cyclohexyl-N-[(3-fluorophenyl)methyl]-3-hydroxy-4-methyl-2-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 151890176 |
| Molecular Formula | C20H27FN2O3 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-cyclohexyl-N-[(3-fluorophenyl)methyl]-3-hydroxy-4-methyl-2-oxopiperidine-3-carboxamide |
| SMILES | CC1CCN(C2CCCCC2)C(=O)C1(O)C(=O)NCc1cccc(F)c1 |
| InChI | InChI=1S/C20H27FN2O3/c1-14-10-11-23(17-8-3-2-4-9-17)19(25)20(14,26)18(24)22-13-15-6-5-7-16(21)12-15/h5-7,12,14,17,26H,2-4,8-11,13H2,1H3,(H,22,24) |
| InChIKey | SQOKOQAZSPHUCJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|