About (3-amino-4-methyl-2-oxochromen-7-yl) prop-2-enoate
(3-amino-4-methyl-2-oxochromen-7-yl) prop-2-enoate (PubChem CID 151891341) has the molecular formula C13H11NO4
and a molecular weight of 245.23 g/mol. Its IUPAC name is (3-amino-4-methyl-2-oxochromen-7-yl) prop-2-enoate.
Molecular Properties
| Compound Name | (3-amino-4-methyl-2-oxochromen-7-yl) prop-2-enoate |
| PubChem CID | 151891341 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (3-amino-4-methyl-2-oxochromen-7-yl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc2c(C)c(N)c(=O)oc2c1 |
| InChI | InChI=1S/C13H11NO4/c1-3-11(15)17-8-4-5-9-7(2)12(14)13(16)18-10(9)6-8/h3-6H,1,14H2,2H3 |
| InChIKey | SQULHHUOAGCZGC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-amino-4-methyl-2-oxochromen-7-yl) prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-4-methyl-2-oxochromen-7-yl) prop-2-enoate?
The IUPAC name of (3-amino-4-methyl-2-oxochromen-7-yl) prop-2-enoate (CID 151891341) is (3-amino-4-methyl-2-oxochromen-7-yl) prop-2-enoate.
What is the SMILES notation for (3-amino-4-methyl-2-oxochromen-7-yl) prop-2-enoate?
The canonical SMILES for (3-amino-4-methyl-2-oxochromen-7-yl) prop-2-enoate is C=CC(=O)Oc1ccc2c(C)c(N)c(=O)oc2c1.
What is the InChIKey of (3-amino-4-methyl-2-oxochromen-7-yl) prop-2-enoate?
The InChIKey is SQULHHUOAGCZGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO4/c1-3-11(15)17-8-4-5-9-7(2)12(14)13(16)18-10(9)6-8/h3-6H,1,14H2,2H3.
What are the key properties of (3-amino-4-methyl-2-oxochromen-7-yl) prop-2-enoate?
(3-amino-4-methyl-2-oxochromen-7-yl) prop-2-enoate has a molecular weight of 245.23 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-4-methyl-2-oxochromen-7-yl) prop-2-enoate is sourced from PubChem (CID 151891341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).