About [3-[(E)-but-2-enoyl]oxy-6-oxobenzo[c]chromen-8-yl] (E)-but-2-enoate
[3-[(E)-but-2-enoyl]oxy-6-oxobenzo[c]chromen-8-yl] (E)-but-2-enoate (PubChem CID 169238748) has the molecular formula C21H16O6
and a molecular weight of 364.35 g/mol. Its IUPAC name is [3-[(E)-but-2-enoyl]oxy-6-oxobenzo[c]chromen-8-yl] (E)-but-2-enoate.
Molecular Properties
| Compound Name | [3-[(E)-but-2-enoyl]oxy-6-oxobenzo[c]chromen-8-yl] (E)-but-2-enoate |
| PubChem CID | 169238748 |
| Molecular Formula | C21H16O6 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | [3-[(E)-but-2-enoyl]oxy-6-oxobenzo[c]chromen-8-yl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)Oc1ccc2c(c1)oc(=O)c1cc(OC(=O)/C=C/C)ccc12 |
| InChI | InChI=1S/C21H16O6/c1-3-5-19(22)25-13-7-9-15-16-10-8-14(26-20(23)6-4-2)12-18(16)27-21(24)17(15)11-13/h3-12H,1-2H3/b5-3+,6-4+ |
| InChIKey | PBEHXDMRZPUSDU-GGWOSOGESA-N |
| XLogP | 3.91 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze [3-[(E)-but-2-enoyl]oxy-6-oxobenzo[c]chromen-8-yl] (E)-but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(E)-but-2-enoyl]oxy-6-oxobenzo[c]chromen-8-yl] (E)-but-2-enoate?
The IUPAC name of [3-[(E)-but-2-enoyl]oxy-6-oxobenzo[c]chromen-8-yl] (E)-but-2-enoate (CID 169238748) is [3-[(E)-but-2-enoyl]oxy-6-oxobenzo[c]chromen-8-yl] (E)-but-2-enoate.
What is the SMILES notation for [3-[(E)-but-2-enoyl]oxy-6-oxobenzo[c]chromen-8-yl] (E)-but-2-enoate?
The canonical SMILES for [3-[(E)-but-2-enoyl]oxy-6-oxobenzo[c]chromen-8-yl] (E)-but-2-enoate is C/C=C/C(=O)Oc1ccc2c(c1)oc(=O)c1cc(OC(=O)/C=C/C)ccc12.
What is the InChIKey of [3-[(E)-but-2-enoyl]oxy-6-oxobenzo[c]chromen-8-yl] (E)-but-2-enoate?
The InChIKey is PBEHXDMRZPUSDU-GGWOSOGESA-N. The full InChI is InChI=1S/C21H16O6/c1-3-5-19(22)25-13-7-9-15-16-10-8-14(26-20(23)6-4-2)12-18(16)27-21(24)17(15)11-13/h3-12H,1-2H3/b5-3+,6-4+.
What are the key properties of [3-[(E)-but-2-enoyl]oxy-6-oxobenzo[c]chromen-8-yl] (E)-but-2-enoate?
[3-[(E)-but-2-enoyl]oxy-6-oxobenzo[c]chromen-8-yl] (E)-but-2-enoate has a molecular weight of 364.35 g/mol, XLogP of 3.91, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(E)-but-2-enoyl]oxy-6-oxobenzo[c]chromen-8-yl] (E)-but-2-enoate is sourced from PubChem (CID 169238748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).