About 2-oxo-3-sulfopentanoic acid
2-oxo-3-sulfopentanoic acid (PubChem CID 151903506) has the molecular formula C5H8O6S
and a molecular weight of 196.18 g/mol. Its IUPAC name is 2-oxo-3-sulfopentanoic acid.
Molecular Properties
| Compound Name | 2-oxo-3-sulfopentanoic acid |
| PubChem CID | 151903506 |
| Molecular Formula | C5H8O6S |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | 2-oxo-3-sulfopentanoic acid |
| SMILES | CCC(C(=O)C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C5H8O6S/c1-2-3(12(9,10)11)4(6)5(7)8/h3H,2H2,1H3,(H,7,8)(H,9,10,11) |
| InChIKey | STGJXOCQMZWTCN-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-3-sulfopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-3-sulfopentanoic acid?
The IUPAC name of 2-oxo-3-sulfopentanoic acid (CID 151903506) is 2-oxo-3-sulfopentanoic acid.
What is the SMILES notation for 2-oxo-3-sulfopentanoic acid?
The canonical SMILES for 2-oxo-3-sulfopentanoic acid is CCC(C(=O)C(=O)O)S(=O)(=O)O.
What is the InChIKey of 2-oxo-3-sulfopentanoic acid?
The InChIKey is STGJXOCQMZWTCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O6S/c1-2-3(12(9,10)11)4(6)5(7)8/h3H,2H2,1H3,(H,7,8)(H,9,10,11).
What are the key properties of 2-oxo-3-sulfopentanoic acid?
2-oxo-3-sulfopentanoic acid has a molecular weight of 196.18 g/mol, XLogP of -0.69, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-3-sulfopentanoic acid is sourced from PubChem (CID 151903506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).