C25H35N3O — CID 151905560
1-methyl-6-[5-[(nonylamino)methyl]-3-pyridinyl]-3,4-dihydroquinolin-2-one (PubChem CID 151905560) has the molecular formula C25H35N3O and a molecular weight of 393.58 g/mol. Its IUPAC name is 1-methyl-6-[5-[(nonylamino)methyl]-3-pyridinyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-methyl-6-[5-[(nonylamino)methyl]-3-pyridinyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 151905560 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | 1-methyl-6-[5-[(nonylamino)methyl]-3-pyridinyl]-3,4-dihydroquinolin-2-one |
| SMILES | CCCCCCCCCNCc1cncc(-c2ccc3c(c2)CCC(=O)N3C)c1 |
| InChI | InChI=1S/C25H35N3O/c1-3-4-5-6-7-8-9-14-26-17-20-15-23(19-27-18-20)21-10-12-24-22(16-21)11-13-25(29)28(24)2/h10,12,15-16,18-19,26H,3-9,11,13-14,17H2,1-2H3 |
| InChIKey | STQVSNJUVZCJGU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|