C17H17N3O2 — CID 123991591
2-[5-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-pyridinyl]acetamide (PubChem CID 123991591) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[5-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-pyridinyl]acetamide.
| Compound Name | 2-[5-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 123991591 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-[5-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-pyridinyl]acetamide |
| SMILES | CN1C(=O)CCc2cc(-c3cncc(CC(N)=O)c3)ccc21 |
| InChI | InChI=1S/C17H17N3O2/c1-20-15-4-2-12(8-13(15)3-5-17(20)22)14-6-11(7-16(18)21)9-19-10-14/h2,4,6,8-10H,3,5,7H2,1H3,(H2,18,21) |
| InChIKey | YHFDYSATUBPLOD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |