C22H19ClN4O2 — CID 78320873
N-(6-chloro-2-pyridinyl)-2-[5-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-pyridinyl]acetamide (PubChem CID 78320873) has the molecular formula C22H19ClN4O2 and a molecular weight of 406.87 g/mol. Its IUPAC name is N-(6-chloro-2-pyridinyl)-2-[5-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-pyridinyl]acetamide.
| Compound Name | N-(6-chloro-2-pyridinyl)-2-[5-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 78320873 |
| Molecular Formula | C22H19ClN4O2 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-(6-chloro-2-pyridinyl)-2-[5-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-pyridinyl]acetamide |
| SMILES | CN1C(=O)CCc2cc(-c3cncc(CC(=O)Nc4cccc(Cl)n4)c3)ccc21 |
| InChI | InChI=1S/C22H19ClN4O2/c1-27-18-7-5-15(11-16(18)6-8-22(27)29)17-9-14(12-24-13-17)10-21(28)26-20-4-2-3-19(23)25-20/h2-5,7,9,11-13H,6,8,10H2,1H3,(H,25,26,28) |
| InChIKey | NSXWOMUYILNYRX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|