C12H22O6 — CID 151905647
2,2,3-trimethoxy-3-[3-(oxiran-2-ylmethoxy)propyl]oxetane (PubChem CID 151905647) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is 2,2,3-trimethoxy-3-[3-(oxiran-2-ylmethoxy)propyl]oxetane.
| Compound Name | 2,2,3-trimethoxy-3-[3-(oxiran-2-ylmethoxy)propyl]oxetane |
|---|---|
| PubChem CID | 151905647 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2,2,3-trimethoxy-3-[3-(oxiran-2-ylmethoxy)propyl]oxetane |
| SMILES | COC1(CCCOCC2CO2)COC1(OC)OC |
| InChI | InChI=1S/C12H22O6/c1-13-11(9-18-12(11,14-2)15-3)5-4-6-16-7-10-8-17-10/h10H,4-9H2,1-3H3 |
| InChIKey | STRGZEHLIASCNP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|