C20H19NO5 — CID 151907060
3-[(6-carboxy-2-methoxy-3-methylphenyl)methyl]-1-methylindole-5-carboxylic acid (PubChem CID 151907060) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is 3-[(6-carboxy-2-methoxy-3-methylphenyl)methyl]-1-methylindole-5-carboxylic acid.
| Compound Name | 3-[(6-carboxy-2-methoxy-3-methylphenyl)methyl]-1-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 151907060 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 3-[(6-carboxy-2-methoxy-3-methylphenyl)methyl]-1-methylindole-5-carboxylic acid |
| SMILES | COc1c(C)ccc(C(=O)O)c1Cc1cn(C)c2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C20H19NO5/c1-11-4-6-14(20(24)25)16(18(11)26-3)9-13-10-21(2)17-7-5-12(19(22)23)8-15(13)17/h4-8,10H,9H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | STYQCGFQUHDISP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |