C15H28O2 — CID 151913068
5,5,6,6-tetramethylundec-3-yne-2,2-diol (PubChem CID 151913068) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 5,5,6,6-tetramethylundec-3-yne-2,2-diol.
| Compound Name | 5,5,6,6-tetramethylundec-3-yne-2,2-diol |
|---|---|
| PubChem CID | 151913068 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 5,5,6,6-tetramethylundec-3-yne-2,2-diol |
| SMILES | CCCCCC(C)(C)C(C)(C)C#CC(C)(O)O |
| InChI | InChI=1S/C15H28O2/c1-7-8-9-10-13(2,3)14(4,5)11-12-15(6,16)17/h16-17H,7-10H2,1-6H3 |
| InChIKey | SVEOWRPNKBEGTB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|