C16H17ClN2O4 — CID 151926408
3-O-[[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]methyl] 1-O-ethyl propanedioate (PubChem CID 151926408) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is 3-O-[[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]methyl] 1-O-ethyl propanedioate.
| Compound Name | 3-O-[[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]methyl] 1-O-ethyl propanedioate |
|---|---|
| PubChem CID | 151926408 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-O-[[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]methyl] 1-O-ethyl propanedioate |
| SMILES | CCOC(=O)CC(=O)OCc1cnn(Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H17ClN2O4/c1-2-22-15(20)7-16(21)23-11-13-8-18-19(10-13)9-12-3-5-14(17)6-4-12/h3-6,8,10H,2,7,9,11H2,1H3 |
| InChIKey | SXVOKQAQHDNPHM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|