C19H21F3N2O5 — CID 169150710
[1-[[4-[(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enoxy]phenyl]methyl]pyrazol-4-yl]methyl 2-methoxyacetate (PubChem CID 169150710) has the molecular formula C19H21F3N2O5 and a molecular weight of 414.38 g/mol. Its IUPAC name is [1-[[4-[(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enoxy]phenyl]methyl]pyrazol-4-yl]methyl 2-methoxyacetate.
| Compound Name | [1-[[4-[(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enoxy]phenyl]methyl]pyrazol-4-yl]methyl 2-methoxyacetate |
|---|---|
| PubChem CID | 169150710 |
| Molecular Formula | C19H21F3N2O5 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [1-[[4-[(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enoxy]phenyl]methyl]pyrazol-4-yl]methyl 2-methoxyacetate |
| SMILES | CCO/C(=C\Oc1ccc(Cn2cc(COC(=O)COC)cn2)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H21F3N2O5/c1-3-27-17(19(20,21)22)12-28-16-6-4-14(5-7-16)9-24-10-15(8-23-24)11-29-18(25)13-26-2/h4-8,10,12H,3,9,11,13H2,1-2H3/b17-12- |
| InChIKey | DCGDRSVOSHATEG-ATVHPVEESA-N |
| XLogP | 3.44 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|