C35H48N2O6S — CID 87531790
[1-[(4-methylphenyl)methyl]pyrazol-4-yl]methyl 4-(1,1,1-tributoxy-2-methyl-3-oxopropan-2-yl)sulfanylbenzoate (PubChem CID 87531790) has the molecular formula C35H48N2O6S and a molecular weight of 624.84 g/mol. Its IUPAC name is [1-[(4-methylphenyl)methyl]pyrazol-4-yl]methyl 4-(1,1,1-tributoxy-2-methyl-3-oxopropan-2-yl)sulfanylbenzoate.
| Compound Name | [1-[(4-methylphenyl)methyl]pyrazol-4-yl]methyl 4-(1,1,1-tributoxy-2-methyl-3-oxopropan-2-yl)sulfanylbenzoate |
|---|---|
| PubChem CID | 87531790 |
| Molecular Formula | C35H48N2O6S |
| Molecular Weight | 624.84 g/mol |
| Exact Mass | 624.32 |
| IUPAC Name | [1-[(4-methylphenyl)methyl]pyrazol-4-yl]methyl 4-(1,1,1-tributoxy-2-methyl-3-oxopropan-2-yl)sulfanylbenzoate |
| SMILES | CCCCOC(OCCCC)(OCCCC)C(C)(C=O)Sc1ccc(C(=O)OCc2cnn(Cc3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C35H48N2O6S/c1-6-9-20-41-35(42-21-10-7-2,43-22-11-8-3)34(5,27-38)44-32-18-16-31(17-19-32)33(39)40-26-30-23-36-37(25-30)24-29-14-12-28(4)13-15-29/h12-19,23,25,27H,6-11,20-22,24,26H2,1-5H3 |
| InChIKey | LTAZQLWGLBEDSS-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.84 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|