C17H17F3N2O4 — CID 163702414
1-[1-[[3-[(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enoxy]phenoxy]methyl]pyrazol-4-yl]ethanone (PubChem CID 163702414) has the molecular formula C17H17F3N2O4 and a molecular weight of 370.33 g/mol. Its IUPAC name is 1-[1-[[3-[(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enoxy]phenoxy]methyl]pyrazol-4-yl]ethanone.
| Compound Name | 1-[1-[[3-[(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enoxy]phenoxy]methyl]pyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 163702414 |
| Molecular Formula | C17H17F3N2O4 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-[1-[[3-[(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enoxy]phenoxy]methyl]pyrazol-4-yl]ethanone |
| SMILES | CCO/C(=C\Oc1cccc(OCn2cc(C(C)=O)cn2)c1)C(F)(F)F |
| InChI | InChI=1S/C17H17F3N2O4/c1-3-24-16(17(18,19)20)10-25-14-5-4-6-15(7-14)26-11-22-9-13(8-21-22)12(2)23/h4-10H,3,11H2,1-2H3/b16-10- |
| InChIKey | KCEDJAHAKCYVKC-YBEGLDIGSA-N |
| XLogP | 3.94 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|