C18H18F4N2O4 — CID 166964953
ethyl 1-[[3-[(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enoxy]-2-fluorophenyl]methyl]pyrazole-4-carboxylate (PubChem CID 166964953) has the molecular formula C18H18F4N2O4 and a molecular weight of 402.34 g/mol. Its IUPAC name is ethyl 1-[[3-[(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enoxy]-2-fluorophenyl]methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[[3-[(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enoxy]-2-fluorophenyl]methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 166964953 |
| Molecular Formula | C18H18F4N2O4 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | ethyl 1-[[3-[(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enoxy]-2-fluorophenyl]methyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(Cc2cccc(O/C=C(\OCC)C(F)(F)F)c2F)c1 |
| InChI | InChI=1S/C18H18F4N2O4/c1-3-26-15(18(20,21)22)11-28-14-7-5-6-12(16(14)19)9-24-10-13(8-23-24)17(25)27-4-2/h5-8,10-11H,3-4,9H2,1-2H3/b15-11- |
| InChIKey | SNUAWLNGCYENJE-PTNGSMBKSA-N |
| XLogP | 4.07 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|