C12H14F4N6 — CID 151928924
3-butyl-7-(3,3,4,4-tetrafluoropyrrolidin-1-yl)triazolo[4,5-d]pyrimidine (PubChem CID 151928924) has the molecular formula C12H14F4N6 and a molecular weight of 318.28 g/mol. Its IUPAC name is 3-butyl-7-(3,3,4,4-tetrafluoropyrrolidin-1-yl)triazolo[4,5-d]pyrimidine.
| Compound Name | 3-butyl-7-(3,3,4,4-tetrafluoropyrrolidin-1-yl)triazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 151928924 |
| Molecular Formula | C12H14F4N6 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 3-butyl-7-(3,3,4,4-tetrafluoropyrrolidin-1-yl)triazolo[4,5-d]pyrimidine |
| SMILES | CCCCn1nnc2c(N3CC(F)(F)C(F)(F)C3)ncnc21 |
| InChI | InChI=1S/C12H14F4N6/c1-2-3-4-22-10-8(19-20-22)9(17-7-18-10)21-5-11(13,14)12(15,16)6-21/h7H,2-6H2,1H3 |
| InChIKey | SYJAOWPJLCCPKK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|