C22H26BrNO2 — CID 151929620
(4-bromophenyl)-[4-[(1-butylpyrrolidin-2-yl)methoxy]phenyl]methanone (PubChem CID 151929620) has the molecular formula C22H26BrNO2 and a molecular weight of 416.36 g/mol. Its IUPAC name is (4-bromophenyl)-[4-[(1-butylpyrrolidin-2-yl)methoxy]phenyl]methanone.
| Compound Name | (4-bromophenyl)-[4-[(1-butylpyrrolidin-2-yl)methoxy]phenyl]methanone |
|---|---|
| PubChem CID | 151929620 |
| Molecular Formula | C22H26BrNO2 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (4-bromophenyl)-[4-[(1-butylpyrrolidin-2-yl)methoxy]phenyl]methanone |
| SMILES | CCCCN1CCCC1COc1ccc(C(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H26BrNO2/c1-2-3-14-24-15-4-5-20(24)16-26-21-12-8-18(9-13-21)22(25)17-6-10-19(23)11-7-17/h6-13,20H,2-5,14-16H2,1H3 |
| InChIKey | SYMWCORWULKXRS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |